ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332-77-4 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans |
|
Nama produk | 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans |
Nama bahasa Inggris | 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans;2,5-Dihydro-2,5-dimethoxyfuran;2,5-Dimethoxy-2,5-dihydrofuran;(2R,5R)-2,5-dimethoxy-2,5-dihydrofuran;(2R,5S)-2,5-dimethoxy-2,5-dihydrofuran;(2S,5S)-2,5-dimethoxy-2,5-dihydrofuran |
MF | C6H10O3 |
Berat Molekul | 130.1418 |
InChI | InChI=1/C6H10O3/c1-7-5-3-4-6(8-2)9-5/h3-6H,1-2H3/t5-,6-/m0/s1 |
CAS NO | 332-77-4 |
EINECS | 206-367-5 |
Struktur Molekul | |
Kepadatan | 1.06g/cm3 |
Titik didih | 161°C at 760 mmHg |
Indeks bias | 1.448 |
Titik nyala | 47.2°C |
Tekanan uap | 3.02mmHg at 25°C |
Simbol bahaya | Xn##Harmful:; |
Kode Risiko | R10:; |
Keselamatan Deskripsi | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S39##Wear eye/face protection.:; |
MSDS |