ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
(4-fluorophenylthio)acetic acid |
|
Nama produk | (4-fluorophenylthio)acetic acid |
Nama bahasa Inggris | (4-fluorophenylthio)acetic acid;2-[(4-Fluorophenyl)thio]acetic acid;[(4-fluorophenyl)sulfanyl]acetic acid;[(4-fluorophenyl)sulfanyl]acetate;2-(4-Fluorophenylthio)acetic acid |
MF | C8H6FO2S |
Berat Molekul | 185.196 |
InChI | InChI=1/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
CAS NO | 332-51-4 |
Struktur Molekul | |
Titik lebur | 76-79℃ |
Titik didih | 315.4°C at 760 mmHg |
Titik nyala | 144.5°C |
Tekanan uap | 0.000185mmHg at 25°C |
Simbol bahaya | Xi##Irritant:; |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |