ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Fluorophenoxy-ethylbromide |
|
Nama produk | 4-Fluorophenoxy-ethylbromide |
Nama bahasa Inggris | 4-Fluorophenoxy-ethylbromide;1-(2-Bromoethoxy)-4-fluorobenzene;1-(1-bromoethoxy)-4-fluorobenzene |
MF | C8H8BrFO |
Berat Molekul | 219.0509 |
InChI | InChI=1/C8H8BrFO/c1-6(9)11-8-4-2-7(10)3-5-8/h2-6H,1H3 |
CAS NO | 332-48-9 |
Struktur Molekul | |
Kepadatan | 1.483g/cm3 |
Titik didih | 242.309°C at 760 mmHg |
Indeks bias | 1.525 |
Titik nyala | 119.849°C |
Tekanan uap | 0.053mmHg at 25°C |
Simbol bahaya | Xi##Irritant:; |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |