ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332-43-4 1-(2-chloroethyl)-4-fluorobenzene |
|
Nama produk | 1-(2-chloroethyl)-4-fluorobenzene |
Nama bahasa Inggris | 1-(2-chloroethyl)-4-fluorobenzene;4-Fluorophenethyl chloride~2-(4-Fluorophenyl)ethyl chloride |
MF | C8H8ClF |
Berat Molekul | 158.6005 |
InChI | InChI=1/C8H8ClF/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2 |
CAS NO | 332-43-4 |
EINECS | 206-364-9 |
Struktur Molekul | ![]() |
Kepadatan | 1.15g/cm3 |
Titik didih | 204.6°C at 760 mmHg |
Indeks bias | 1.501 |
Titik nyala | 79.9°C |
Tekanan uap | 0.373mmHg at 25°C |
Kode Risiko | R36/38##Irritating to eyes and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |