ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
324-42-5 2-fluoro-6-metilnaftalena |
|
Nama produk | 2-fluoro-6-metilnaftalena |
Nama bahasa Inggris | 2-fluoro-6-methylnaphthalene; |
MF | C11H9F |
Berat Molekul | 160.1876 |
InChI | InChI=1/C11H9F/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-7H,1H3 |
CAS NO | 324-42-5 |
Struktur Molekul | |
Kepadatan | 1.112g/cm3 |
Titik lebur | 72℃ |
Titik didih | 247.5°C at 760 mmHg |
Indeks bias | 1.594 |
Titik nyala | 84.5°C |
Tekanan uap | 0.0403mmHg at 25°C |
Simbol bahaya | Xi##Irritant:; |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |