ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
31874-34-7 2,4-Dimethoxybenzaldoxime |
|
Nama produk | 2,4-Dimethoxybenzaldoxime |
Nama bahasa Inggris | 2,4-Dimethoxybenzaldoxime;1-(2,4-dimethoxyphenyl)-N-hydroxymethanimine;2,4-dimethoxybenzaldehyde oxime |
MF | C9H11NO3 |
Berat Molekul | 181.1885 |
InChI | InChI=1/C9H11NO3/c1-12-8-4-3-7(6-10-11)9(5-8)13-2/h3-6,11H,1-2H3/b10-6+ |
CAS NO | 31874-34-7 |
Struktur Molekul | |
Kepadatan | 1.11g/cm3 |
Titik didih | 304.9°C at 760 mmHg |
Indeks bias | 1.501 |
Titik nyala | 138.2°C |
Tekanan uap | 0.000372mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |