ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-98-5 2- (2-thienyl) -1,3-thiazole-4-carbonyl chloride |
|
Nama produk | 2- (2-thienyl) -1,3-thiazole-4-carbonyl chloride |
Sinonim | 2-tiofen-2-il-1,3-tiazol-4-karbonil klorida; |
Nama bahasa Inggris | 2-(2-thienyl)-1,3-thiazole-4-carbonyl chloride;2-thiophen-2-yl-1,3-thiazole-4-carbonyl chloride |
MF | C8H4ClNOS2 |
Berat Molekul | 229.7065 |
InChI | InChI=1/C8H4ClNOS2/c9-7(11)5-4-13-8(10-5)6-2-1-3-12-6/h1-4H |
CAS NO | 306934-98-5 |
Struktur Molekul | ![]() |
Kepadatan | 1.498g/cm3 |
Titik lebur | 90℃ |
Titik didih | 371.6°C at 760 mmHg |
Indeks bias | 1.65 |
Titik nyala | 178.5°C |
Tekanan uap | 1.02E-05mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R34##Causes burns.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |