Chemindex > 306934-98-5
ID ▼
306934-98-5 2- (2-thienyl) -1,3-thiazole-4-carbonyl chloride |
|
| Nama produk | 2- (2-thienyl) -1,3-thiazole-4-carbonyl chloride |
| Sinonim | 2-tiofen-2-il-1,3-tiazol-4-karbonil klorida; |
| Nama bahasa Inggris | 2-(2-thienyl)-1,3-thiazole-4-carbonyl chloride;2-thiophen-2-yl-1,3-thiazole-4-carbonyl chloride |
| MF | C8H4ClNOS2 |
| Berat Molekul | 229.7065 |
| InChI | InChI=1/C8H4ClNOS2/c9-7(11)5-4-13-8(10-5)6-2-1-3-12-6/h1-4H |
| CAS NO | 306934-98-5 |
| Struktur Molekul |  |
| Kepadatan | 1.498g/cm3 |
| Titik lebur | 90℃ |
| Titik didih | 371.6°C at 760 mmHg |
| Indeks bias | 1.65 |
| Titik nyala | 178.5°C |
| Tekanan uap | 1.02E-05mmHg at 25°C |
| Simbol bahaya |  C##Corrosive:; |
| Kode Risiko | R34##Causes burns.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Pemasok seharga 306934-98-5 (0):
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 