ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
30506-30-0 1-Bromo-4-(ethylthio)benzene |
|
Nama produk | 1-Bromo-4-(ethylthio)benzene |
Nama bahasa Inggris | 1-Bromo-4-(ethylthio)benzene;4-Bromophenyl ethyl sulphide~4-(Ethylthio)bromobenzene;1-bromo-4-(ethylsulfanyl)benzene |
MF | C8H9BrS |
Berat Molekul | 217.1261 |
InChI | InChI=1/C8H9BrS/c1-2-10-8-5-3-7(9)4-6-8/h3-6H,2H2,1H3 |
CAS NO | 30506-30-0 |
Struktur Molekul | |
Kepadatan | 1.44g/cm3 |
Titik didih | 259.1°C at 760 mmHg |
Indeks bias | 1.606 |
Titik nyala | 110.5°C |
Tekanan uap | 0.0214mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |