ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Iodoacetic acid, sodium salt |
|
Nama produk | Iodoacetic acid, sodium salt |
Nama bahasa Inggris | Iodoacetic acid, sodium salt;Sodium iodoacetate;Iodoacetic acid sodium salt |
MF | C2H2INaO2 |
Berat Molekul | 207.9303 |
InChI | InChI=1/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
CAS NO | 305-53-3 |
EINECS | 206-165-7 |
Struktur Molekul | |
Titik lebur | 208-210℃ |
Titik didih | 262.1°C at 760 mmHg |
Titik nyala | 112.3°C |
Tekanan uap | 0.00329mmHg at 25°C |
Simbol bahaya | T##Toxic:; |
Kode Risiko | R25##Toxic if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S22##Do not inhale dust.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |