ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
305-15-7 2,5-Dichlorophenylhydrazine |
|
Nama produk | 2,5-Dichlorophenylhydrazine |
Nama bahasa Inggris | 2,5-Dichlorophenylhydrazine ;-2,5-DICHLOROPHENYLHYDRAZINE;1-(2,5-DICHLOROPHENYL)HYDRAZINE;(2,5-dichlorophenyl)-hydrazin;Hydrazine, (2,5-dichlorophenyl)-;2,5-DICHLOROPHENYLHYRAZINE |
MF | C6H6Cl2N2 |
Berat Molekul | 177.0312 |
InChI | InChI=1/C6H6Cl2N2/c7-4-1-2-5(8)6(3-4)10-9/h1-3,10H,9H2 |
CAS NO | 305-15-7 |
EINECS | 206-163-6 |
Struktur Molekul | ![]() |
Kepadatan | 1.475g/cm3 |
Titik lebur | 100-104℃ |
Titik didih | 266.8°C at 760 mmHg |
Indeks bias | 1.665 |
Titik nyala | 115.1°C |
Tekanan uap | 0.00848mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |