ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2777-65-3 10-Undecynoic acid |
|
Nama produk | 10-Undecynoic acid |
Nama bahasa Inggris | 10-Undecynoic acid; |
MF | C11H18O2 |
Berat Molekul | 182.2594 |
InChI | InChI=1/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2,(H,12,13) |
CAS NO | 2777-65-3 |
EINECS | 220-471-8 |
Struktur Molekul | |
Kepadatan | 0.966g/cm3 |
Titik didih | 297.7°C at 760 mmHg |
Indeks bias | 1.468 |
Titik nyala | 142.9°C |
Tekanan uap | 0.000317mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |