ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
260-94-6 Acridine |
|
Nama produk | Acridine |
Nama bahasa Inggris | Acridine;Dibenzo[b,e]pyridine |
MF | C13H9N |
Berat Molekul | 179.2173 |
InChI | InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
CAS NO | 260-94-6 |
EINECS | 205-971-6 |
Struktur Molekul | |
Kepadatan | 1.187g/cm3 |
Titik lebur | 105-110℃ |
Titik didih | 346.7°C at 760 mmHg |
Indeks bias | 1.726 |
Titik nyala | 153.8°C |
Tekanan uap | 0.000113mmHg at 25°C |
Simbol bahaya | Xn##Harmful:; |
Kode Risiko | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |