ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
23039-94-3 tris(3-fluorophenyl)phosphine |
|
Nama produk | tris(3-fluorophenyl)phosphine |
Nama bahasa Inggris | tris(3-fluorophenyl)phosphine;Tris(3-fluorophenyl)phosphine;tris(3-fluorophenyl)phosphane;Tri(3-fluorophenyl)phosphine |
MF | C18H12F3P |
Berat Molekul | 316.2569 |
InChI | InChI=1/C18H12F3P/c19-13-4-1-7-16(10-13)22(17-8-2-5-14(20)11-17)18-9-3-6-15(21)12-18/h1-12H |
CAS NO | 23039-94-3 |
Struktur Molekul | ![]() |
Titik didih | 371.1°C at 760 mmHg |
Titik nyala | 178.2°C |
Tekanan uap | 2.26E-05mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |