ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
229-87-8 Phenanthridine |
|
Nama produk | Phenanthridine |
Nama bahasa Inggris | Phenanthridine;Phenanthridine;3,4-Benzoquinoline;Phenanthridine, (Benzo[c]quinoline) |
MF | C13H9N |
Berat Molekul | 179.2173 |
InChI | InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
CAS NO | 229-87-8 |
EINECS | 205-934-4 |
Struktur Molekul | |
Kepadatan | 1.187g/cm3 |
Titik lebur | 104-107℃ |
Titik didih | 340.8°C at 760 mmHg |
Indeks bias | 1.726 |
Titik nyala | 155.9°C |
Tekanan uap | 0.000166mmHg at 25°C |
Simbol bahaya | Xn##Harmful:; |
Kode Risiko | R40##Possible risks of irreversible effects.:; |
Keselamatan Deskripsi | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |