ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22135-50-8 4-(4-methoxyphenyl)-1-butanol |
|
Nama produk | 4-(4-methoxyphenyl)-1-butanol |
Nama bahasa Inggris | 4-(4-methoxyphenyl)-1-butanol;4-(4-methoxyphenyl)butan-1-ol;1-(4-methoxyphenyl)butan-1-ol |
MF | C11H16O2 |
Berat Molekul | 180.2435 |
InChI | InChI=1/C11H16O2/c1-13-11-7-5-10(6-8-11)4-2-3-9-12/h5-8,12H,2-4,9H2,1H3 |
CAS NO | 22135-50-8;52244-70-9 |
EINECS | 257-782-3 |
Struktur Molekul | ![]() |
Kepadatan | 1.019g/cm3 |
Titik lebur | 3-4℃ |
Titik didih | 304.7°C at 760 mmHg |
Indeks bias | 1.514 |
Titik nyala | 130.9°C |
Tekanan uap | 0.000377mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |