ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216394-06-8 (1R,2R)-(-)-2-Benzyloxycyclohexylamine |
|
Nama produk | (1R,2R)-(-)-2-Benzyloxycyclohexylamine |
Nama bahasa Inggris | (1R,2R)-(-)-2-Benzyloxycyclohexylamine;(1R,2R)-(-)-1-Amino-2-benzyloxycyclohexane;(1R-trans)-(-)-2-(Phenylmethoxy)cyclohexanamine;(1R-trans)-2-(Phenylmethoxy)cyclohexaneamine;(1R,2R)-2-(benzyloxy)cyclohexanamine;(1R,2R)-2-phenylmethoxycyclohexan-1-amine |
MF | C13H19NO |
Berat Molekul | 205.2961 |
InChI | InChI=1/C13H19NO/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10,14H2/t12-,13-/m1/s1 |
CAS NO | 216394-06-8 |
Struktur Molekul | ![]() |
Kepadatan | 1.039g/cm3 |
Titik didih | 306.148°C at 760 mmHg |
Indeks bias | 1.545 |
Titik nyala | 133.224°C |
Tekanan uap | 0.001mmHg at 25°C |
Kode Risiko | R34##Causes burns.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |