ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
19819-98-8 2-Methylphenethyl alcohol |
|
Nama produk | 2-Methylphenethyl alcohol |
Nama bahasa Inggris | 2-Methylphenethyl alcohol;2-o-tolylethanol;2-(2-Methylphenyl)ethanol |
MF | C9H12O |
Berat Molekul | 136.191 |
InChI | InChI=1/C9H12O/c1-8-4-2-3-5-9(8)6-7-10/h2-5,10H,6-7H2,1H3 |
CAS NO | 19819-98-8 |
EINECS | 243-349-6 |
Struktur Molekul | |
Kepadatan | 1.001g/cm3 |
Titik didih | 243.5°C at 760 mmHg |
Indeks bias | 1.532 |
Titik nyala | 108.3°C |
Tekanan uap | 0.0172mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |