ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
14922-36-2 4-Nitrophenylglyoxylic acid |
|
Nama produk | 4-Nitrophenylglyoxylic acid |
Nama bahasa Inggris | 4-Nitrophenylglyoxylic acid;4-Nitrobenzoylformic acid;(4-nitrophenyl)(oxo)acetic acid |
MF | C8H5NO5 |
Berat Molekul | 195.129 |
InChI | InChI=1/C8H5NO5/c10-7(8(11)12)5-1-3-6(4-2-5)9(13)14/h1-4H,(H,11,12) |
CAS NO | 14922-36-2 |
Struktur Molekul | |
Kepadatan | 1.531g/cm3 |
Titik didih | 381.6°C at 760 mmHg |
Indeks bias | 1.613 |
Titik nyala | 173.1°C |
Tekanan uap | 1.67E-06mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |