Chemindex > 110-49-6
ID ▼
2-Methoxyethyl acetate |
|
| Nama produk | 2-Methoxyethyl acetate |
| Nama bahasa Inggris | 2-Methoxyethyl acetate;Methyl Cellosolve?acetate;1-Acetoxy-2-methoxyethane;Ethylene glycol monomethyl ether acetate;Methyl Cellosolve(rg acetate;2-sulfanylethyl acetate |
| MF | C4H8O2S |
| Berat Molekul | 120.1701 |
| InChI | InChI=1/C4H8O2S/c1-4(5)6-2-3-7/h7H,2-3H2,1H3 |
| CAS NO | 110-49-6 |
| EINECS | 203-772-9 |
| Struktur Molekul |  |
| Kepadatan | 1.072g/cm3 |
| Titik lebur | -65℃ |
| Titik didih | 162.7°C at 760 mmHg |
| Indeks bias | 1.452 |
| Titik nyala | 57.6°C |
| Tekanan uap | 2.14mmHg at 25°C |
| Simbol bahaya |  T##Toxic:; |
| Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R60##May impair fertility.||R61##May cause harm to the unborn child.:; |
| Keselamatan Deskripsi | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 