ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Methyl caprate |
|
Nama produk | Methyl caprate |
Nama bahasa Inggris | Methyl caprate;Methyl decanoate;Capric acid methyl ester~Decanoic acid methyl ester~Methyl decanoate;METHYLE N-CAPRINATE |
MF | C11H22O2 |
Berat Molekul | 186.2912 |
InChI | InChI=1/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3 |
CAS NO | 110-42-9 |
EINECS | 203-766-6 |
Struktur Molekul | |
Kepadatan | 0.872g/cm3 |
Titik lebur | -11--14℃ |
Titik didih | 224°C at 760 mmHg |
Indeks bias | 1.426 |
Titik nyala | 94.4°C |
Tekanan uap | 0.0934mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |