ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
106-57-0 Glycine anhydride |
|
Nama produk | Glycine anhydride |
Nama bahasa Inggris | Glycine anhydride;2,5-Diketopiperazine;2,5-Piperazinedione,(Glycine anhydride);Dioxo Piperazine;Cyclo(-Gly-Gly);2,5-Piperazinedione;piperazine-2,5-dione;piperazine-2,3-dione |
MF | C4H6N2O2 |
Berat Molekul | 114.1026 |
InChI | InChI=1/C4H6N2O2/c7-3-4(8)6-2-1-5-3/h1-2H2,(H,5,7)(H,6,8) |
CAS NO | 106-57-0 |
EINECS | 203-411-5 |
Struktur Molekul | |
Kepadatan | 1.246g/cm3 |
Titik lebur | 300℃ |
Indeks bias | 1.467 |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |