ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
105-08-8 1,4-Cyclohexanedimethanol, mixture of cisand trans |
|
Nama produk | 1,4-Cyclohexanedimethanol, mixture of cisand trans |
Nama bahasa Inggris | 1,4-Cyclohexanedimethanol, mixture of cisand trans;1,4-Bis(hydroxymethyl)cyclohexane;cyclohex-1,4-ylenedimethanol;1,4-Cyclohexane dimethanol;cyclohexane-1,4-diyldimethanol;1,4-Cyclohexanedimethanol;CHDM |
MF | C8H16O2 |
Berat Molekul | 144.2114 |
InChI | InChI=1/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2 |
CAS NO | 105-08-8 |
EINECS | 203-268-9 |
Struktur Molekul | |
Kepadatan | 1.004g/cm3 |
Titik lebur | 31.5℃ |
Titik didih | 286.2°C at 760 mmHg |
Indeks bias | 1.47 |
Titik nyala | 161.1°C |
Kelarutan air | miscible |
Tekanan uap | 0.000303mmHg at 25°C |
Kode Risiko | R36:; |
Keselamatan Deskripsi | S26||S39:; |
MSDS |