ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
104-45-0 1-Metoksik-4-propilbenzena |
|
Nama produk | 1-Metoksik-4-propilbenzena |
Sinonim | ; 4-Propilanisol = Dihidroanethole = p-Propylanisole; 4-n-Propylanisole; |
Nama bahasa Inggris | 1-Methoxy-4-propylbenzene;4-Propylanisole = Dihydroanethole = p-Propylanisole;4-n-Propylanisole |
MF | C10H14O |
Berat Molekul | 150.2176 |
InChI | InChI=1/C10H14O/c1-3-4-9-5-7-10(11-2)8-6-9/h5-8H,3-4H2,1-2H3 |
CAS NO | 104-45-0 |
EINECS | 203-203-4 |
Struktur Molekul | |
Kepadatan | 0.922g/cm3 |
Titik didih | 211.4°C at 760 mmHg |
Indeks bias | 1.49 |
Titik nyala | 82.3°C |
Tekanan uap | 0.266mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |