Chemindex > 103-94-6
ID ▼
4-Nitrophenyloxamic acid |
|
| Nama produk | 4-Nitrophenyloxamic acid |
| Nama bahasa Inggris | 4-Nitrophenyloxamic acid;4-Nitrooxanilic acid;[(4-nitrophenyl)amino](oxo)acetic acid |
| MF | C8H6N2O5 |
| Berat Molekul | 210.1436 |
| InChI | InChI=1/C8H6N2O5/c11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h1-4H,(H,9,11)(H,12,13) |
| CAS NO | 103-94-6 |
| EINECS | 203-160-1 |
| Struktur Molekul |  |
| Kepadatan | 1.629g/cm3 |
| Indeks bias | 1.678 |
| Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Pemasok seharga 103-94-6 (0):
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 