ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-78-6 cyclohexylacetone |
|
Nama produk | cyclohexylacetone |
Nama bahasa Inggris | cyclohexylacetone;Cyclohexylacetone, (Acetonylcyclohexane);Acetonylcyclohexane;Cyclohexyacetone;1-cyclohexylpropan-2-one;1-cyclohexylacetone |
MF | C9H16O |
Berat Molekul | 140.2227 |
InChI | InChI=1/C9H16O/c1-8(10)7-9-5-3-2-4-6-9/h9H,2-7H2,1H3 |
CAS NO | 103-78-6 |
EINECS | 203-143-9 |
Struktur Molekul | |
Kepadatan | 0.889g/cm3 |
Titik didih | 188.1°C at 760 mmHg |
Indeks bias | 1.441 |
Titik nyala | 65.3°C |
Tekanan uap | 0.609mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |