ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
trans-Stilbene |
|
Nama produk | trans-Stilbene |
Nama bahasa Inggris | trans-Stilbene;trans-1,1-(1,2-Ethenediyl)bis(benzene);1,1'-ethene-1,1-diyldibenzene;1,1'-(E)-ethene-1,2-diyldibenzene;1,1'-(Z)-ethene-1,2-diyldibenzene |
MF | C14H12 |
Berat Molekul | 180.2451 |
InChI | InChI=1/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
CAS NO | 103-30-0 |
EINECS | 203-098-5 |
Struktur Molekul | |
Kepadatan | 1.044g/cm3 |
Titik lebur | 122-126℃ |
Titik didih | 307°C at 760 mmHg |
Indeks bias | 1.658 |
Titik nyala | 128.5°C |
Tekanan uap | 0.00135mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |