ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
102-85-2 Tributyl phosphite |
|
Nama produk | Tributyl phosphite |
Nama bahasa Inggris | Tributyl phosphite;Tri-n-butyl phosphite |
MF | C12H27O3P |
Berat Molekul | 250.3147 |
InChI | InChI=1/C12H27O3P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-12H2,1-3H3 |
CAS NO | 102-85-2 |
EINECS | 203-061-3 |
Struktur Molekul | |
Titik lebur | -80℃ |
Titik didih | 268.1°C at 760 mmHg |
Titik nyala | 121.1°C |
Tekanan uap | 0.013mmHg at 25°C |
Simbol bahaya | Xn##Harmful:; |
Kode Risiko | R21##Harmful in contact with skin.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |