ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
MCPB |
|
termék neve | MCPB |
Angol név | MCPB;4-(4-Chloro-o-tolyloxy)butyric acid;2,4-MCPB;4-(4-Chloro-2-methylphenoxy)butyric acid;MCPB;4-(2-Methyl-4-chlorophenoxy)butyric acid;2-(4-chloro-2-methylphenoxy)butanoic acid |
MF | C11H13ClO3 |
Molekulatömeg | 228.6721 |
InChI | InChI=1/C11H13ClO3/c1-3-9(11(13)14)15-10-5-4-8(12)6-7(10)2/h4-6,9H,3H2,1-2H3,(H,13,14) |
CAS-szám | 94-81-5 |
EINECS | 202-365-3 |
Molekuláris szerkezete | |
Sűrűség | 1.228g/cm3 |
Forráspont | 345.1°C at 760 mmHg |
Törésmutató | 1.536 |
Gyulladáspont | 162.5°C |
Gőznyomás | 2.39E-05mmHg at 25°C |
Kockázatot kódok | R22##Harmful if swallowed.:; |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
MSDS |