ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
ethyl 4-(butylamino)benzoate |
|
termék neve | ethyl 4-(butylamino)benzoate |
Angol név | ethyl 4-(butylamino)benzoate;Ethyl 4-(n-butylamino)benzoate;4-(n-Butylamino)benzoic acid ethyl ester;Ethyl-4-n-butylamino-benzoate |
MF | C13H19NO2 |
Molekulatömeg | 221.2955 |
InChI | InChI=1/C13H19NO2/c1-3-5-10-14-12-8-6-11(7-9-12)13(15)16-4-2/h6-9,14H,3-5,10H2,1-2H3 |
CAS-szám | 94-32-6 |
EINECS | 202-322-9 |
Molekuláris szerkezete | |
Sűrűség | 1.039g/cm3 |
Olvadáspont | 68-70℃ |
Forráspont | 338.4°C at 760 mmHg |
Törésmutató | 1.534 |
Gyulladáspont | 158.4°C |
Gőznyomás | 9.87E-05mmHg at 25°C |
Biztonsági Leírás | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |