ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
n-Propylthiourea |
|
termék neve | n-Propylthiourea |
Angol név | n-Propylthiourea;Propyl-2-thiourea;Propylthiourea;Thiourea, propyl-;1-propylthiourea |
MF | C4H10N2S |
Molekulatömeg | 118.2006 |
InChI | InChI=1/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
CAS-szám | 927-67-3 |
EINECS | 213-158-2 |
Molekuláris szerkezete | |
Sűrűség | 1.054g/cm3 |
Forráspont | 182.1°C at 760 mmHg |
Törésmutató | 1.537 |
Gyulladáspont | 63.9°C |
Gőznyomás | 0.825mmHg at 25°C |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Biztonsági Leírás | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |