ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,3-Benzanthracene |
|
termék neve | 2,3-Benzanthracene |
Angol név | 2,3-Benzanthracene;NAPHTHACENE;Chrysogen;LT-S940;Tetracene |
MF | C18H12 |
Molekulatömeg | 228.2879 |
InChI | InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
CAS-szám | 92-24-0 |
EINECS | 202-138-9 |
Molekuláris szerkezete | |
Sűrűség | 1.19g/cm3 |
Olvadáspont | 300℃ |
Forráspont | 436.7°C at 760 mmHg |
Törésmutató | 1.771 |
Gyulladáspont | 209.1°C |
Gőznyomás | 2.02E-07mmHg at 25°C |
Veszély szimbólumok | Xn##Harmful:; |
Kockázatot kódok | R40##Possible risks of irreversible effects.:; |
Biztonsági Leírás | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |