ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Hydroxy-4,6-dimethoxyacetophenone |
|
termék neve | 2-Hydroxy-4,6-dimethoxyacetophenone |
Angol név | 2-Hydroxy-4,6-dimethoxyacetophenone;xanthoxylin |
MF | C10H12O4 |
Molekulatömeg | 196.1999 |
InChI | InChI=1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
CAS-szám | 90-24-4 |
EINECS | 201-978-3 |
Molekuláris szerkezete | |
Sűrűség | 1.172g/cm3 |
Olvadáspont | 80-82℃ |
Forráspont | 355.1°C at 760 mmHg |
Törésmutató | 1.527 |
Gyulladáspont | 141.2°C |
Gőznyomás | 1.57E-05mmHg at 25°C |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |