ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-52-5 Gramine |
|
termék neve | Gramine |
Angol név | Gramine;3-(Dimethylaminomethyl)indole;(1H-Indol-3-ylmethyl)-dimethyl-amine |
MF | C11H14N2 |
Molekulatömeg | 174.2423 |
InChI | InChI=1/C11H14N2/c1-13(2)8-9-7-12-11-6-4-3-5-10(9)11/h3-7,12H,8H2,1-2H3 |
CAS-szám | 87-52-5 |
EINECS | 201-749-8 |
Molekuláris szerkezete | |
Sűrűség | 1.099g/cm3 |
Olvadáspont | 131-139℃ |
Forráspont | 293.9°C at 760 mmHg |
Törésmutató | 1.63 |
Gyulladáspont | 131.5°C |
Vízben való oldhatóság | PRACTICALLY INSOLUBLE |
Gőznyomás | 0.00168mmHg at 25°C |
Veszély szimbólumok | Xi##Irritant:; |
Kockázatot kódok | R36##Irritating to eyes.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S46##If swallowed, seek medical advice immediately and show this container or label.:; |
MSDS |