ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
cinnamyl anthranilate |
|
termék neve | cinnamyl anthranilate |
Angol név | cinnamyl anthranilate;2-Aminobenzoic acid cinnamyl ester~Cinnamyl anthranilate;3-phenylprop-2-en-1-yl 2-aminobenzoate;(2E)-3-phenylprop-2-en-1-yl 2-aminobenzoate |
MF | C16H15NO2 |
Molekulatömeg | 253.2958 |
InChI | InChI=1/C16H15NO2/c17-15-11-5-4-10-14(15)16(18)19-12-6-9-13-7-2-1-3-8-13/h1-11H,12,17H2/b9-6+ |
CAS-szám | 87-29-6 |
EINECS | 201-738-8 |
Molekuláris szerkezete | |
Sűrűség | 1.178g/cm3 |
Forráspont | 449.1°C at 760 mmHg |
Törésmutató | 1.642 |
Gyulladáspont | 269.4°C |
Gőznyomás | 2.95E-08mmHg at 25°C |
Biztonsági Leírás | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |