ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-26-0 2-Methoxybiphenyl |
|
termék neve | 2-Methoxybiphenyl |
Angol név | 2-Methoxybiphenyl;2-Phenylanisole;biphenyl-2-yl methyl ether;o-Methoxybiphenyl |
MF | C13H12O |
Molekulatömeg | 184.2338 |
InChI | InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
CAS-szám | 86-26-0 |
EINECS | 201-659-9 |
Molekuláris szerkezete | |
Sűrűség | 1.03g/cm3 |
Olvadáspont | 30-33℃ |
Forráspont | 274°C at 760 mmHg |
Törésmutató | 1.556 |
Gyulladáspont | 101.3°C |
Gőznyomás | 0.00928mmHg at 25°C |
Veszély szimbólumok | Xn##Harmful:; |
Kockázatot kódok | R33##Danger of cummulative effects.:; |
Biztonsági Leírás | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |