ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 85-02-9 5,6-Benzoquinoline | |
| termék neve | 5,6-Benzoquinoline | 
| Angol név | 5,6-Benzoquinoline;beta-Naphthoquinoline;1-Azaphenanthrene;Benzo[f]quinoline;Benzoquinoline;benzo(f)quinoline | 
| MF | C13H9N | 
| Molekulatömeg | 179.2173 | 
| InChI | InChI=1/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H | 
| CAS-szám | 85-02-9 | 
| EINECS | 201-582-0 | 
| Molekuláris szerkezete |  | 
| Sűrűség | 1.187g/cm3 | 
| Olvadáspont | 89-91℃ | 
| Forráspont | 350.4°C at 760 mmHg | 
| Törésmutató | 1.726 | 
| Gyulladáspont | 155.9°C | 
| Gőznyomás | 8.89E-05mmHg at 25°C | 
| Veszély szimbólumok | |
| Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.||R40##Possible risks of irreversible effects.:; | 
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
| MSDS | |