ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Diethyl sec-Butylmalonate |
|
termék neve | Diethyl sec-Butylmalonate |
Angol név | Diethyl sec-Butylmalonate;Butylmalonicaciddiethylester;sec-Butylmalonic acid diethyl ester;diethyl butan-2-ylpropanedioate;diethyl [(1S)-1-methylpropyl]propanedioate;diethyl [(1R)-1-methylpropyl]propanedioate |
MF | C11H20O4 |
Molekulatömeg | 216.2741 |
InChI | InChI=1/C11H20O4/c1-5-8(4)9(10(12)14-6-2)11(13)15-7-3/h8-9H,5-7H2,1-4H3/t8-/m1/s1 |
CAS-szám | 83-27-2 |
EINECS | 201-463-3 |
Molekuláris szerkezete | |
Sűrűség | 0.992g/cm3 |
Forráspont | 247.5°C at 760 mmHg |
Törésmutató | 1.431 |
Gyulladáspont | 103.1°C |
Gőznyomás | 0.0256mmHg at 25°C |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
MSDS |