ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-(chloromethyl)-2,4-dimethylbenzene |
|
termék neve | 1-(chloromethyl)-2,4-dimethylbenzene |
Angol név | 1-(chloromethyl)-2,4-dimethylbenzene;2,4-Dimethylbenzyl chloride;4-(Chloromethyl)-m-xylene;2,4-Dimethylbenzylchloride |
MF | C9H11Cl |
Molekulatömeg | 154.6366 |
InChI | InChI=1/C9H11Cl/c1-7-3-4-9(6-10)8(2)5-7/h3-5H,6H2,1-2H3 |
CAS-szám | 824-55-5 |
EINECS | 212-531-7 |
Molekuláris szerkezete | |
Sűrűség | 1.033g/cm3 |
Forráspont | 215.5°C at 760 mmHg |
Törésmutató | 1.522 |
Gyulladáspont | 86.5°C |
Gőznyomás | 0.216mmHg at 25°C |
Veszély szimbólumok | C##Corrosive:; |
Kockázatot kódok | R34##Causes burns.||R36##Irritating to eyes.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |