ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
D-Lysergic acid hydrate |
|
termék neve | D-Lysergic acid hydrate |
Angol név | D-Lysergic acid hydrate;9,10-Didehydro-6-methylergoline-8-carboxylic acid;lysergic acid;(8beta)-6-methyl-9,10-didehydroergoline-8-carboxylic acid;6-methyl-9,10-didehydroergoline-8-carboxylic acid;9,10-Didehydro-6-Methyl-Ergoline-8-Carboxylic Acid |
MF | C16H16N2O2 |
Molekulatömeg | 268.3104 |
InChI | InChI=1/C16H16N2O2/c1-18-8-10(16(19)20)5-12-11-3-2-4-13-15(11)9(7-17-13)6-14(12)18/h2-5,7,10,14,17H,6,8H2,1H3,(H,19,20)/t10?,14-/m1/s1 |
CAS-szám | 82-58-6 |
EINECS | 201-431-9 |
Molekuláris szerkezete | |
Sűrűség | 1.39g/cm3 |
Olvadáspont | 220℃ |
Forráspont | 536.2°C at 760 mmHg |
Törésmutató | 1.725 |
Gyulladáspont | 278.1°C |
Gőznyomás | 2.51E-12mmHg at 25°C |
Veszély szimbólumok | Xn##Harmful:; |
Kockázatot kódok | R40##Possible risks of irreversible effects.:; |
Biztonsági Leírás | S13##Keep away from food, drink and animal feeding stuffs.||S22##Do not inhale dust.||S23##Do not inhale gas/fumes/vapour/spray.:; |
MSDS |