ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,1'-diantrimid |
|
termék neve | 1,1'-diantrimid |
Szinonimák | ; 1,1-iminodiantrakinon; 1,1'-iminodiantracén-9,10-dion; |
Angol név | 1,1'-dianthrimide;1,1-iminodianthraquinone;1,1'-iminodianthracene-9,10-dione |
MF | C28H15NO4 |
Molekulatömeg | 429.423 |
InChI | InChI=1/C28H15NO4/c30-25-15-7-1-3-9-17(15)27(32)23-19(25)11-5-13-21(23)29-22-14-6-12-20-24(22)28(33)18-10-4-2-8-16(18)26(20)31/h1-14,29H |
CAS-szám | 82-22-4 |
EINECS | 201-405-7 |
Molekuláris szerkezete | |
Sűrűség | 1.456g/cm3 |
Olvadáspont | 300℃ |
Forráspont | 667.1°C at 760 mmHg |
Törésmutató | 1.753 |
Gyulladáspont | 221.6°C |
Gőznyomás | 1.17E-17mmHg at 25°C |
Veszély szimbólumok | Xi##Irritant:; |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |