ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
818-88-2 mono-methyl sebacate |
|
termék neve | mono-methyl sebacate |
Angol név | mono-methyl sebacate;Monomethyl sebacate~Sebacic acid monomethyl ester;Sebacic acid monomethyl ester;Methyl hydrogen sebacate (Monomethyl sebacate; Sebacic acid monomethyl ester);monomethyl sebacate;10-methoxy-10-oxodecanoic acid |
MF | C11H20O4 |
Molekulatömeg | 216.2741 |
InChI | InChI=1/C11H20O4/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13) |
CAS-szám | 818-88-2 |
EINECS | 212-458-0 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.038g/cm3 |
Olvadáspont | 41-44℃ |
Forráspont | 332.5°C at 760 mmHg |
Törésmutató | 1.453 |
Gyulladáspont | 115.4°C |
Gőznyomás | 2.8E-05mmHg at 25°C |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
MSDS |