ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81593-28-4 2,5-Difluor-fenil-glioxál-hidrát |
|
termék neve | 2,5-Difluor-fenil-glioxál-hidrát |
Szinonimák | (2,5-difluorfenil) (oxo)acetaldehid-hidrát; |
Angol név | 2,5-Difluorophenylglyoxal hydrate;(2,5-difluorophenyl)(oxo)acetaldehyde hydrate |
MF | C8H6F2O3 |
Molekulatömeg | 188.1282 |
InChI | InChI=1/C8H4F2O2.H2O/c9-5-1-2-7(10)6(3-5)8(12)4-11;/h1-4H;1H2 |
CAS-szám | 81593-28-4 |
Molekuláris szerkezete | |
Forráspont | 224.7°C at 760 mmHg |
Gyulladáspont | 84.7°C |
Gőznyomás | 0.0899mmHg at 25°C |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |