ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Malonsav-d2 sav-d2 |
|
termék neve | Malonsav-d2 sav-d2 |
Szinonimák | ; Malonsav-d4; (~2~H_2_)propán(~2~H_2_)dioinsav; |
Angol név | Malonic-d2 acid-d2;Malonic acid-d4;(~2~H_2_)propane(~2~H_2_)dioic acid |
MF | C3D4O4 |
Molekulatömeg | 108.0861 |
InChI | InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
CAS-szám | 813-56-9 |
EINECS | 212-385-4 |
Molekuláris szerkezete | |
Sűrűség | 1.605g/cm3 |
Olvadáspont | 130-132℃ |
Forráspont | 386.8°C at 760 mmHg |
Törésmutató | 1.478 |
Gyulladáspont | 201.9°C |
Gőznyomás | 4.66E-07mmHg at 25°C |
Veszély szimbólumok | Xn##Harmful:; |
Kockázatot kódok | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |