ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,1-dichloro-2,2-difluoroethylene |
|
termék neve | 1,1-dichloro-2,2-difluoroethylene |
Angol név | 1,1-dichloro-2,2-difluoroethylene;FC-1112a;1-chloro-1,2,2-trifluoroethene |
MF | C2Cl2F2 |
Molekulatömeg | 132.9242 |
InChI | InChI=1/C2Cl2F2/c3-1(4)2(5)6 |
CAS-szám | 79-35-6 |
EINECS | 201-198-3 |
Molekuláris szerkezete | |
Sűrűség | 1.503g/cm3 |
Forráspont | 17.3°C at 760 mmHg |
Törésmutató | 1.392 |
Gőznyomás | 999mmHg at 25°C |
Kockázatot kódok | R23##Toxic by inhalation.||R36/38##Irritating to eyes and skin.:; |
Biztonsági Leírás | S23##Do not inhale gas/fumes/vapour/spray.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S9##Keep container in a well-ventilated place.:; |
MSDS |