ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
780-05-2 N-(4-fluorophenyl)maleamic acid |
|
termék neve | N-(4-fluorophenyl)maleamic acid |
Angol név | N-(4-fluorophenyl)maleamic acid;Maleic acid mono(4-fluorophenyl)amide;(2Z)-4-[(4-fluorophenyl)amino]-4-oxobut-2-enoic acid |
MF | C10H8FNO3 |
Molekulatömeg | 209.1738 |
InChI | InChI=1/C10H8FNO3/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(14)15/h1-6H,(H,12,13)(H,14,15)/b6-5- |
CAS-szám | 780-05-2 |
Molekuláris szerkezete | |
Sűrűség | 1.413g/cm3 |
Olvadáspont | 207-209℃ |
Forráspont | 437.3°C at 760 mmHg |
Törésmutató | 1.611 |
Gyulladáspont | 218.2°C |
Gőznyomás | 2.03E-08mmHg at 25°C |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |