ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane |
|
termék neve | 3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane |
Angol név | 3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane;3,9-Divinylspirobis(m-dioxan);3,9-diethenyl-2,4,8,10-tetraoxaspiro[5.5]undecane;3,9-Divinylspirobi(m-dioxane);3,9-Divinyl-2,4,8,10-tetraoxaspiro(5.5)undecane |
MF | C11H16O4 |
Molekulatömeg | 212.2423 |
InChI | InChI=1/C11H16O4/c1-3-9-12-5-11(6-13-9)7-14-10(4-2)15-8-11/h3-4,9-10H,1-2,5-8H2 |
CAS-szám | 78-19-3 |
EINECS | 201-092-7 |
Molekuláris szerkezete | |
Sűrűség | 1.11g/cm3 |
Olvadáspont | 43-46℃ |
Forráspont | 284.4°C at 760 mmHg |
Törésmutató | 1.493 |
Gyulladáspont | 106.6°C |
Gőznyomás | 0.00512mmHg at 25°C |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
MSDS |