ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
76393-18-5 2,6-dibromo-4-(fluorophenyl)isocyanate |
|
termék neve | 2,6-dibromo-4-(fluorophenyl)isocyanate |
Angol név | 2,6-dibromo-4-(fluorophenyl)isocyanate; |
MF | C7H2Br2FNO |
Molekulatömeg | 294.9033 |
InChI | InChI=1/C7H2Br2FNO/c8-5-1-4(10)2-6(9)7(5)11-3-12/h1-2H |
CAS-szám | 76393-18-5 |
Molekuláris szerkezete | |
Sűrűség | 2.01g/cm3 |
Olvadáspont | 42-45℃ |
Forráspont | 295.5°C at 760 mmHg |
Törésmutató | 1.614 |
Gyulladáspont | 132.5°C |
Gőznyomás | 0.00152mmHg at 25°C |
Kockázatot kódok | R20/22##Harmful by inhalation and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.||R42##May cause sensitization by inhalation.:; |
Biztonsági Leírás | S22##Do not inhale dust.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |