ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Bromodichloromethane |
|
termék neve | Bromodichloromethane |
Angol név | Bromodichloromethane;FC-20B1 |
MF | CHBrCl2 |
Molekulatömeg | 163.8286 |
InChI | InChI=1/CHBrCl2/c2-1(3)4/h1H |
CAS-szám | 75-27-4 |
EINECS | 200-856-7 |
Molekuláris szerkezete | |
Sűrűség | 2.013g/cm3 |
Olvadáspont | -55℃ |
Forráspont | 89.7°C at 760 mmHg |
Törésmutató | 1.503 |
Gyulladáspont | 1.3°C |
Gőznyomás | 65.3mmHg at 25°C |
Veszély szimbólumok | Xn##Harmful:; |
Kockázatot kódok | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
Biztonsági Leírás | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |