ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
720-44-5 4-Methoxybenzhydrol |
|
termék neve | 4-Methoxybenzhydrol |
Angol név | 4-Methoxybenzhydrol;4-Methoxydiphenylmethanol~4-Methoxyphenyl phenyl carbinol;(4-methoxyphenyl)(phenyl)methanol |
MF | C14H14O2 |
Molekulatömeg | 214.2598 |
InChI | InChI=1/C14H14O2/c1-16-13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11/h2-10,14-15H,1H3 |
CAS-szám | 720-44-5 |
EINECS | 211-953-9 |
Molekuláris szerkezete | |
Sűrűség | 1.121g/cm3 |
Forráspont | 363.2°C at 760 mmHg |
Törésmutató | 1.582 |
Gyulladáspont | 164.5°C |
Gőznyomás | 6.55E-06mmHg at 25°C |
Biztonsági Leírás | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |