ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
5-Methylnicotinamide |
|
termék neve | 5-Methylnicotinamide |
Angol név | 5-Methylnicotinamide;5-Methylpyridine-3-carboxamide |
MF | C7H8N2O |
Molekulatömeg | 136.1512 |
InChI | InChI=1/C7H8N2O/c1-5-2-6(7(8)10)4-9-3-5/h2-4H,1H3,(H2,8,10) |
CAS-szám | 70-57-5 |
Molekuláris szerkezete | |
Sűrűség | 1.157g/cm3 |
Forráspont | 290°C at 760 mmHg |
Törésmutató | 1.561 |
Gyulladáspont | 129.2°C |
Gőznyomás | 0.00213mmHg at 25°C |
Biztonsági Leírás | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |